C13H20O2 — CID 162833892
(1R,3R,7S,8S,9R)-9-methoxy-3-methyl-2-methylidenetricyclo[5.2.1.03,8]decan-9-ol (PubChem CID 162833892) has the molecular formula C13H20O2 and a molecular weight of 208.30 g/mol. Its IUPAC name is (1R,3R,7S,8S,9R)-9-methoxy-3-methyl-2-methylidenetricyclo[5.2.1.03,8]decan-9-ol.
| Compound Name | (1R,3R,7S,8S,9R)-9-methoxy-3-methyl-2-methylidenetricyclo[5.2.1.03,8]decan-9-ol |
|---|---|
| PubChem CID | 162833892 |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.15 |
| IUPAC Name | (1R,3R,7S,8S,9R)-9-methoxy-3-methyl-2-methylidenetricyclo[5.2.1.03,8]decan-9-ol |
| SMILES | C=C1C2C[C@@H]3CCC[C@]1(C)[C@H]3[C@]2(O)OC |
| InChI | InChI=1S/C13H20O2/c1-8-10-7-9-5-4-6-12(8,2)11(9)13(10,14)15-3/h9-11,14H,1,4-7H2,2-3H3/t9-,10?,11-,12-,13+/m0/s1 |
| InChIKey | KVDNDRKELNLBLO-HNMFLPSRSA-N |
| XLogP | 2.33 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|