C14H25BO — CID 175638200
CID 175638200 (PubChem CID 175638200) has the molecular formula C14H25BO and a molecular weight of 220.16 g/mol.
| Compound Name | CID 175638200 |
|---|---|
| PubChem CID | 175638200 |
| Molecular Formula | C14H25BO |
| Molecular Weight | 220.16 g/mol |
| Exact Mass | 220.20 |
| IUPAC Name | — |
| SMILES | [B][C@]1(O)CCC[C@H]2CCCCCC[C@H]2CC1 |
| InChI | InChI=1S/C14H25BO/c15-14(16)10-5-8-12-6-3-1-2-4-7-13(12)9-11-14/h12-13,16H,1-11H2/t12-,13+,14+/m1/s1 |
| InChIKey | CDHHIYPCMMZTOV-RDBSUJKOSA-N |
| XLogP | 3.39 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.16 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|