C14H22O2 — CID 163049441
[(1R,2S,3R,7R,8S,9R)-9-methoxy-7-methyl-10-methylidene-2-tricyclo[5.2.1.03,8]decanyl]methanol (PubChem CID 163049441) has the molecular formula C14H22O2 and a molecular weight of 222.33 g/mol. Its IUPAC name is [(1R,2S,3R,7R,8S,9R)-9-methoxy-7-methyl-10-methylidene-2-tricyclo[5.2.1.03,8]decanyl]methanol.
| Compound Name | [(1R,2S,3R,7R,8S,9R)-9-methoxy-7-methyl-10-methylidene-2-tricyclo[5.2.1.03,8]decanyl]methanol |
|---|---|
| PubChem CID | 163049441 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | [(1R,2S,3R,7R,8S,9R)-9-methoxy-7-methyl-10-methylidene-2-tricyclo[5.2.1.03,8]decanyl]methanol |
| SMILES | C=C1C2[C@@H](CO)[C@H]3CCC[C@]1(C)[C@H]3[C@@H]2OC |
| InChI | InChI=1S/C14H22O2/c1-8-11-10(7-15)9-5-4-6-14(8,2)12(9)13(11)16-3/h9-13,15H,1,4-7H2,2-3H3/t9-,10+,11?,12-,13-,14+/m1/s1 |
| InChIKey | AIJNIJKGHUVIFA-UOHALXPSSA-N |
| XLogP | 2.23 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|