C23H21NO5 — CID 1123360
[2,6-dimethoxy-4-[(4S)-2-oxo-3,4-dihydro-1H-benzo[h]quinolin-4-yl]phenyl] acetate (PubChem CID 1123360) has the molecular formula C23H21NO5 and a molecular weight of 391.42 g/mol. Its IUPAC name is [2,6-dimethoxy-4-[(4S)-2-oxo-3,4-dihydro-1H-benzo[h]quinolin-4-yl]phenyl] acetate.
| Compound Name | [2,6-dimethoxy-4-[(4S)-2-oxo-3,4-dihydro-1H-benzo[h]quinolin-4-yl]phenyl] acetate |
|---|---|
| PubChem CID | 1123360 |
| Molecular Formula | C23H21NO5 |
| Molecular Weight | 391.42 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | [2,6-dimethoxy-4-[(4S)-2-oxo-3,4-dihydro-1H-benzo[h]quinolin-4-yl]phenyl] acetate |
| SMILES | COc1cc([C@@H]2CC(=O)Nc3c2ccc2ccccc32)cc(OC)c1OC(C)=O |
| InChI | InChI=1S/C23H21NO5/c1-13(25)29-23-19(27-2)10-15(11-20(23)28-3)18-12-21(26)24-22-16-7-5-4-6-14(16)8-9-17(18)22/h4-11,18H,12H2,1-3H3,(H,24,26)/t18-/m0/s1 |
| InChIKey | ZOBXPHFAPGPQNJ-SFHVURJKSA-N |
| XLogP | 4.26 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.42 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|