C19H30N2O4S — CID 11234429
(E)-but-2-enedioic acid;N-(2-methylpropyl)-N-[(3-methylthiophen-2-yl)methyl]piperidin-4-amine (PubChem CID 11234429) has the molecular formula C19H30N2O4S and a molecular weight of 382.53 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;N-(2-methylpropyl)-N-[(3-methylthiophen-2-yl)methyl]piperidin-4-amine.
| Compound Name | (E)-but-2-enedioic acid;N-(2-methylpropyl)-N-[(3-methylthiophen-2-yl)methyl]piperidin-4-amine |
|---|---|
| PubChem CID | 11234429 |
| Molecular Formula | C19H30N2O4S |
| Molecular Weight | 382.53 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | (E)-but-2-enedioic acid;N-(2-methylpropyl)-N-[(3-methylthiophen-2-yl)methyl]piperidin-4-amine |
| SMILES | Cc1ccsc1CN(CC(C)C)C1CCNCC1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C15H26N2S.C4H4O4/c1-12(2)10-17(14-4-7-16-8-5-14)11-15-13(3)6-9-18-15;5-3(6)1-2-4(7)8/h6,9,12,14,16H,4-5,7-8,10-11H2,1-3H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | RCRMCGFJSYQIGS-WLHGVMLRSA-N |
| XLogP | 2.98 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.53 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|