C15H22N2O4S — CID 6434759
(Z)-4-hydroxy-4-oxobut-2-enoate;2-piperidin-1-ium-1-yl-2-thiophen-2-ylethanamine (PubChem CID 6434759) has the molecular formula C15H22N2O4S and a molecular weight of 326.42 g/mol. Its IUPAC name is (Z)-4-hydroxy-4-oxobut-2-enoate;2-piperidin-1-ium-1-yl-2-thiophen-2-ylethanamine.
| Compound Name | (Z)-4-hydroxy-4-oxobut-2-enoate;2-piperidin-1-ium-1-yl-2-thiophen-2-ylethanamine |
|---|---|
| PubChem CID | 6434759 |
| Molecular Formula | C15H22N2O4S |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | (Z)-4-hydroxy-4-oxobut-2-enoate;2-piperidin-1-ium-1-yl-2-thiophen-2-ylethanamine |
| SMILES | NCC(c1cccs1)[NH+]1CCCCC1.O=C([O-])/C=C\C(=O)O |
| InChI | InChI=1S/C11H18N2S.C4H4O4/c12-9-10(11-5-4-8-14-11)13-6-2-1-3-7-13;5-3(6)1-2-4(7)8/h4-5,8,10H,1-3,6-7,9,12H2;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | KMFNIYQGYUDSDZ-BTJKTKAUSA-N |
| XLogP | -0.81 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|