C25H30N2O8S2 — CID 6445715
bis((E)-but-2-enedioic acid);1-methyl-4-(2-phenylsulfanyl-1-thiophen-2-ylethyl)piperazine (PubChem CID 6445715) has the molecular formula C25H30N2O8S2 and a molecular weight of 550.66 g/mol. Its IUPAC name is bis((E)-but-2-enedioic acid);1-methyl-4-(2-phenylsulfanyl-1-thiophen-2-ylethyl)piperazine.
| Compound Name | bis((E)-but-2-enedioic acid);1-methyl-4-(2-phenylsulfanyl-1-thiophen-2-ylethyl)piperazine |
|---|---|
| PubChem CID | 6445715 |
| Molecular Formula | C25H30N2O8S2 |
| Molecular Weight | 550.66 g/mol |
| Exact Mass | 550.14 |
| IUPAC Name | bis((E)-but-2-enedioic acid);1-methyl-4-(2-phenylsulfanyl-1-thiophen-2-ylethyl)piperazine |
| SMILES | CN1CCN(C(CSc2ccccc2)c2cccs2)CC1.O=C(O)/C=C/C(=O)O.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C17H22N2S2.2C4H4O4/c1-18-9-11-19(12-10-18)16(17-8-5-13-20-17)14-21-15-6-3-2-4-7-15;2*5-3(6)1-2-4(7)8/h2-8,13,16H,9-12,14H2,1H3;2*1-2H,(H,5,6)(H,7,8)/b;2*2-1+ |
| InChIKey | PIRZQNNFGBIJBG-LVEZLNDCSA-N |
| XLogP | 3.25 |
| TPSA | 155.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.66 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|