C22H26N2O4S — CID 138752620
(E)-but-2-enedioic acid;1-methyl-4-(4-thiatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),5,10,12-pentaen-8-yl)piperazine (PubChem CID 138752620) has the molecular formula C22H26N2O4S and a molecular weight of 414.53 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;1-methyl-4-(4-thiatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),5,10,12-pentaen-8-yl)piperazine.
| Compound Name | (E)-but-2-enedioic acid;1-methyl-4-(4-thiatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),5,10,12-pentaen-8-yl)piperazine |
|---|---|
| PubChem CID | 138752620 |
| Molecular Formula | C22H26N2O4S |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | (E)-but-2-enedioic acid;1-methyl-4-(4-thiatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),5,10,12-pentaen-8-yl)piperazine |
| SMILES | CN1CCN(C2Cc3ccccc3Cc3sccc32)CC1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C18H22N2S.C4H4O4/c1-19-7-9-20(10-8-19)17-12-14-4-2-3-5-15(14)13-18-16(17)6-11-21-18;5-3(6)1-2-4(7)8/h2-6,11,17H,7-10,12-13H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | JQAABVNFCQIFDG-WLHGVMLRSA-N |
| XLogP | 2.90 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|