C26H22N4 — CID 11234693
N,N-dimethyl-4-(5-naphthalen-1-yl-4-pyridin-4-yl-1H-imidazol-2-yl)aniline (PubChem CID 11234693) has the molecular formula C26H22N4 and a molecular weight of 390.49 g/mol. Its IUPAC name is N,N-dimethyl-4-(5-naphthalen-1-yl-4-pyridin-4-yl-1H-imidazol-2-yl)aniline.
| Compound Name | N,N-dimethyl-4-(5-naphthalen-1-yl-4-pyridin-4-yl-1H-imidazol-2-yl)aniline |
|---|---|
| PubChem CID | 11234693 |
| Molecular Formula | C26H22N4 |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | N,N-dimethyl-4-(5-naphthalen-1-yl-4-pyridin-4-yl-1H-imidazol-2-yl)aniline |
| SMILES | CN(C)c1ccc(-c2nc(-c3ccncc3)c(-c3cccc4ccccc34)[nH]2)cc1 |
| InChI | InChI=1S/C26H22N4/c1-30(2)21-12-10-20(11-13-21)26-28-24(19-14-16-27-17-15-19)25(29-26)23-9-5-7-18-6-3-4-8-22(18)23/h3-17H,1-2H3,(H,28,29) |
| InChIKey | JMMIIHVLFCZWJS-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'} |
|---|