C26H17N2O2- — CID 7030216
4-(5-naphthalen-1-yl-4-phenyl-1H-imidazol-2-yl)benzoate (PubChem CID 7030216) has the molecular formula C26H17N2O2- and a molecular weight of 389.43 g/mol. Its IUPAC name is 4-(5-naphthalen-1-yl-4-phenyl-1H-imidazol-2-yl)benzoate.
| Compound Name | 4-(5-naphthalen-1-yl-4-phenyl-1H-imidazol-2-yl)benzoate |
|---|---|
| PubChem CID | 7030216 |
| Molecular Formula | C26H17N2O2- |
| Molecular Weight | 389.43 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | 4-(5-naphthalen-1-yl-4-phenyl-1H-imidazol-2-yl)benzoate |
| SMILES | O=C([O-])c1ccc(-c2nc(-c3ccccc3)c(-c3cccc4ccccc34)[nH]2)cc1 |
| InChI | InChI=1S/C26H18N2O2/c29-26(30)20-15-13-19(14-16-20)25-27-23(18-8-2-1-3-9-18)24(28-25)22-12-6-10-17-7-4-5-11-21(17)22/h1-16H,(H,27,28)(H,29,30)/p-1 |
| InChIKey | MGYIQSXGMXWYRG-UHFFFAOYSA-M |
| XLogP | 4.93 |
| TPSA | 68.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.43 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imidazole_A(19)', 'substructure': 'N/A'} |
|---|