C24H27FN6 — CID 11235457
6-[5-(diethylaminomethyl)benzimidazol-1-yl]-N-[1-(4-fluorophenyl)ethyl]pyrazin-2-amine (PubChem CID 11235457) has the molecular formula C24H27FN6 and a molecular weight of 418.52 g/mol. Its IUPAC name is 6-[5-(diethylaminomethyl)benzimidazol-1-yl]-N-[1-(4-fluorophenyl)ethyl]pyrazin-2-amine.
| Compound Name | 6-[5-(diethylaminomethyl)benzimidazol-1-yl]-N-[1-(4-fluorophenyl)ethyl]pyrazin-2-amine |
|---|---|
| PubChem CID | 11235457 |
| Molecular Formula | C24H27FN6 |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.23 |
| IUPAC Name | 6-[5-(diethylaminomethyl)benzimidazol-1-yl]-N-[1-(4-fluorophenyl)ethyl]pyrazin-2-amine |
| SMILES | CCN(CC)Cc1ccc2c(c1)ncn2-c1cncc(NC(C)c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C24H27FN6/c1-4-30(5-2)15-18-6-11-22-21(12-18)27-16-31(22)24-14-26-13-23(29-24)28-17(3)19-7-9-20(25)10-8-19/h6-14,16-17H,4-5,15H2,1-3H3,(H,28,29) |
| InChIKey | BODVFQZGSBVBAW-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |