C24H26N4OS — CID 11235461
N-(3,5-dimethylphenyl)-2-[(2-methylprop-2-enylamino)-pyridin-4-ylmethyl]sulfanylpyridine-3-carboxamide (PubChem CID 11235461) has the molecular formula C24H26N4OS and a molecular weight of 418.57 g/mol. Its IUPAC name is N-(3,5-dimethylphenyl)-2-[(2-methylprop-2-enylamino)-pyridin-4-ylmethyl]sulfanylpyridine-3-carboxamide.
| Compound Name | N-(3,5-dimethylphenyl)-2-[(2-methylprop-2-enylamino)-pyridin-4-ylmethyl]sulfanylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 11235461 |
| Molecular Formula | C24H26N4OS |
| Molecular Weight | 418.57 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | N-(3,5-dimethylphenyl)-2-[(2-methylprop-2-enylamino)-pyridin-4-ylmethyl]sulfanylpyridine-3-carboxamide |
| SMILES | C=C(C)CNC(Sc1ncccc1C(=O)Nc1cc(C)cc(C)c1)c1ccncc1 |
| InChI | InChI=1S/C24H26N4OS/c1-16(2)15-27-23(19-7-10-25-11-8-19)30-24-21(6-5-9-26-24)22(29)28-20-13-17(3)12-18(4)14-20/h5-14,23,27H,1,15H2,2-4H3,(H,28,29) |
| InChIKey | TWIZQJFWNKCPJO-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.57 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|