C22H22N4O3S — CID 67219233
N-(3,5-dimethylphenyl)-2-[[(2-hydroxyacetyl)amino]-pyridin-4-ylmethyl]sulfanylpyridine-3-carboxamide (PubChem CID 67219233) has the molecular formula C22H22N4O3S and a molecular weight of 422.51 g/mol. Its IUPAC name is N-(3,5-dimethylphenyl)-2-[[(2-hydroxyacetyl)amino]-pyridin-4-ylmethyl]sulfanylpyridine-3-carboxamide.
| Compound Name | N-(3,5-dimethylphenyl)-2-[[(2-hydroxyacetyl)amino]-pyridin-4-ylmethyl]sulfanylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 67219233 |
| Molecular Formula | C22H22N4O3S |
| Molecular Weight | 422.51 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | N-(3,5-dimethylphenyl)-2-[[(2-hydroxyacetyl)amino]-pyridin-4-ylmethyl]sulfanylpyridine-3-carboxamide |
| SMILES | Cc1cc(C)cc(NC(=O)c2cccnc2SC(NC(=O)CO)c2ccncc2)c1 |
| InChI | InChI=1S/C22H22N4O3S/c1-14-10-15(2)12-17(11-14)25-20(29)18-4-3-7-24-22(18)30-21(26-19(28)13-27)16-5-8-23-9-6-16/h3-12,21,27H,13H2,1-2H3,(H,25,29)(H,26,28) |
| InChIKey | ABEMAKMBVQFVKP-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 104.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.51 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|