C24H25ClN6O2S — CID 67219049
N-(4-chlorophenyl)-2-[[(2-piperazin-1-ylacetyl)amino]-pyridin-4-ylmethyl]sulfanylpyridine-3-carboxamide (PubChem CID 67219049) has the molecular formula C24H25ClN6O2S and a molecular weight of 497.02 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-[[(2-piperazin-1-ylacetyl)amino]-pyridin-4-ylmethyl]sulfanylpyridine-3-carboxamide.
| Compound Name | N-(4-chlorophenyl)-2-[[(2-piperazin-1-ylacetyl)amino]-pyridin-4-ylmethyl]sulfanylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 67219049 |
| Molecular Formula | C24H25ClN6O2S |
| Molecular Weight | 497.02 g/mol |
| Exact Mass | 496.14 |
| IUPAC Name | N-(4-chlorophenyl)-2-[[(2-piperazin-1-ylacetyl)amino]-pyridin-4-ylmethyl]sulfanylpyridine-3-carboxamide |
| SMILES | O=C(CN1CCNCC1)NC(Sc1ncccc1C(=O)Nc1ccc(Cl)cc1)c1ccncc1 |
| InChI | InChI=1S/C24H25ClN6O2S/c25-18-3-5-19(6-4-18)29-22(33)20-2-1-9-28-24(20)34-23(17-7-10-26-11-8-17)30-21(32)16-31-14-12-27-13-15-31/h1-11,23,27H,12-16H2,(H,29,33)(H,30,32) |
| InChIKey | IKWZSUOCVCAHBX-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 99.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.02 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|