C23H28N8O2 — CID 11236233
1,3-dimethyl-8-[3-(4-phenylpiperazin-1-yl)propylamino]purino[7,8-a]pyrimidine-2,4-dione (PubChem CID 11236233) has the molecular formula C23H28N8O2 and a molecular weight of 448.53 g/mol. Its IUPAC name is 1,3-dimethyl-8-[3-(4-phenylpiperazin-1-yl)propylamino]purino[7,8-a]pyrimidine-2,4-dione.
| Compound Name | 1,3-dimethyl-8-[3-(4-phenylpiperazin-1-yl)propylamino]purino[7,8-a]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 11236233 |
| Molecular Formula | C23H28N8O2 |
| Molecular Weight | 448.53 g/mol |
| Exact Mass | 448.23 |
| IUPAC Name | 1,3-dimethyl-8-[3-(4-phenylpiperazin-1-yl)propylamino]purino[7,8-a]pyrimidine-2,4-dione |
| SMILES | Cn1c(=O)c2c(nc3nc(NCCCN4CCN(c5ccccc5)CC4)ccn32)n(C)c1=O |
| InChI | InChI=1S/C23H28N8O2/c1-27-20-19(21(32)28(2)23(27)33)31-12-9-18(25-22(31)26-20)24-10-6-11-29-13-15-30(16-14-29)17-7-4-3-5-8-17/h3-5,7-9,12H,6,10-11,13-16H2,1-2H3,(H,24,25,26) |
| InChIKey | JAPRJDUUOBHNIG-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.53 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|