C36H40N2O6 — CID 11238745
[(1S,4S,5R,6S)-4,5-bis[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]-6-(piperidine-1-carbonyl)cyclohex-2-en-1-yl]-piperidin-1-ylmethanone (PubChem CID 11238745) has the molecular formula C36H40N2O6 and a molecular weight of 596.72 g/mol. Its IUPAC name is [(1S,4S,5R,6S)-4,5-bis[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]-6-(piperidine-1-carbonyl)cyclohex-2-en-1-yl]-piperidin-1-ylmethanone.
| Compound Name | [(1S,4S,5R,6S)-4,5-bis[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]-6-(piperidine-1-carbonyl)cyclohex-2-en-1-yl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 11238745 |
| Molecular Formula | C36H40N2O6 |
| Molecular Weight | 596.72 g/mol |
| Exact Mass | 596.29 |
| IUPAC Name | [(1S,4S,5R,6S)-4,5-bis[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]-6-(piperidine-1-carbonyl)cyclohex-2-en-1-yl]-piperidin-1-ylmethanone |
| SMILES | O=C([C@H]1[C@H](/C=C/c2ccc3c(c2)OCO3)[C@H](/C=C/c2ccc3c(c2)OCO3)C=C[C@@H]1C(=O)N1CCCCC1)N1CCCCC1 |
| InChI | InChI=1S/C36H40N2O6/c39-35(37-17-3-1-4-18-37)29-14-12-27(11-7-25-9-15-30-32(21-25)43-23-41-30)28(34(29)36(40)38-19-5-2-6-20-38)13-8-26-10-16-31-33(22-26)44-24-42-31/h7-16,21-22,27-29,34H,1-6,17-20,23-24H2/b11-7+,13-8+/t27-,28-,29+,34+/m1/s1 |
| InChIKey | GREGGMAPGMHDBQ-FDOKFBTOSA-N |
| XLogP | 5.93 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.72 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|