C27H28F13NO5 — CID 11239404
ethyl (2R)-4-[(4S,5R)-4-benzyl-2-oxo-5-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)-1,3-oxazolidin-3-yl]-4-oxo-2-propan-2-ylbutanoate (PubChem CID 11239404) has the molecular formula C27H28F13NO5 and a molecular weight of 693.50 g/mol. Its IUPAC name is ethyl (2R)-4-[(4S,5R)-4-benzyl-2-oxo-5-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)-1,3-oxazolidin-3-yl]-4-oxo-2-propan-2-ylbutanoate.
| Compound Name | ethyl (2R)-4-[(4S,5R)-4-benzyl-2-oxo-5-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)-1,3-oxazolidin-3-yl]-4-oxo-2-propan-2-ylbutanoate |
|---|---|
| PubChem CID | 11239404 |
| Molecular Formula | C27H28F13NO5 |
| Molecular Weight | 693.50 g/mol |
| Exact Mass | 693.18 |
| IUPAC Name | ethyl (2R)-4-[(4S,5R)-4-benzyl-2-oxo-5-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)-1,3-oxazolidin-3-yl]-4-oxo-2-propan-2-ylbutanoate |
| SMILES | CCOC(=O)[C@H](CC(=O)N1C(=O)O[C@H](CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)[C@@H]1Cc1ccccc1)C(C)C |
| InChI | InChI=1S/C27H28F13NO5/c1-4-45-20(43)16(14(2)3)13-19(42)41-17(12-15-8-6-5-7-9-15)18(46-21(41)44)10-11-22(28,29)23(30,31)24(32,33)25(34,35)26(36,37)27(38,39)40/h5-9,14,16-18H,4,10-13H2,1-3H3/t16-,17+,18-/m1/s1 |
| InChIKey | PJDRBAOBLCHXPO-FGTMMUONSA-N |
| XLogP | 7.69 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.50 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|