C19H18F13NO3 — CID 102292909
ethyl 2-[[benzyl(hydroxy)amino]methyl]-4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononanoate (PubChem CID 102292909) has the molecular formula C19H18F13NO3 and a molecular weight of 555.33 g/mol. Its IUPAC name is ethyl 2-[[benzyl(hydroxy)amino]methyl]-4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononanoate.
| Compound Name | ethyl 2-[[benzyl(hydroxy)amino]methyl]-4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononanoate |
|---|---|
| PubChem CID | 102292909 |
| Molecular Formula | C19H18F13NO3 |
| Molecular Weight | 555.33 g/mol |
| Exact Mass | 555.11 |
| IUPAC Name | ethyl 2-[[benzyl(hydroxy)amino]methyl]-4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononanoate |
| SMILES | CCOC(=O)C(CN(O)Cc1ccccc1)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C19H18F13NO3/c1-2-36-13(34)12(10-33(35)9-11-6-4-3-5-7-11)8-14(20,21)15(22,23)16(24,25)17(26,27)18(28,29)19(30,31)32/h3-7,12,35H,2,8-10H2,1H3 |
| InChIKey | VBGVUSWTWUBVIF-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.33 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|