C10H18N2 — CID 11240701
(4R,4aR,8aR)-4-methyl-3,4,4a,5,6,7,8,8a-octahydroquinolin-2-amine (PubChem CID 11240701) has the molecular formula C10H18N2 and a molecular weight of 166.27 g/mol. Its IUPAC name is (4R,4aR,8aR)-4-methyl-3,4,4a,5,6,7,8,8a-octahydroquinolin-2-amine.
| Compound Name | (4R,4aR,8aR)-4-methyl-3,4,4a,5,6,7,8,8a-octahydroquinolin-2-amine |
|---|---|
| PubChem CID | 11240701 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | (4R,4aR,8aR)-4-methyl-3,4,4a,5,6,7,8,8a-octahydroquinolin-2-amine |
| SMILES | C[C@@H]1CC(N)=N[C@@H]2CCCC[C@H]12 |
| InChI | InChI=1S/C10H18N2/c1-7-6-10(11)12-9-5-3-2-4-8(7)9/h7-9H,2-6H2,1H3,(H2,11,12)/t7-,8-,9-/m1/s1 |
| InChIKey | WFMGCLWNKZKHCB-IWSPIJDZSA-N |
| XLogP | 1.94 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |