C13H13N3O3 — CID 11242379
2-[(4,4-dimethyl-5H-1,3-oxazol-2-yl)methyl]-3-nitrobenzonitrile (PubChem CID 11242379) has the molecular formula C13H13N3O3 and a molecular weight of 259.26 g/mol. Its IUPAC name is 2-[(4,4-dimethyl-5H-1,3-oxazol-2-yl)methyl]-3-nitrobenzonitrile.
| Compound Name | 2-[(4,4-dimethyl-5H-1,3-oxazol-2-yl)methyl]-3-nitrobenzonitrile |
|---|---|
| PubChem CID | 11242379 |
| Molecular Formula | C13H13N3O3 |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | 2-[(4,4-dimethyl-5H-1,3-oxazol-2-yl)methyl]-3-nitrobenzonitrile |
| SMILES | CC1(C)COC(Cc2c(C#N)cccc2[N+](=O)[O-])=N1 |
| InChI | InChI=1S/C13H13N3O3/c1-13(2)8-19-12(15-13)6-10-9(7-14)4-3-5-11(10)16(17)18/h3-5H,6,8H2,1-2H3 |
| InChIKey | WFQDNBUVABQBDM-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 88.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|