C16H28O3 — CID 11242635
[(E,2S)-4-[(1S,3S,6S)-6-hydroxy-2,2,3,6-tetramethylcyclohexyl]but-3-en-2-yl] acetate (PubChem CID 11242635) has the molecular formula C16H28O3 and a molecular weight of 268.40 g/mol. Its IUPAC name is [(E,2S)-4-[(1S,3S,6S)-6-hydroxy-2,2,3,6-tetramethylcyclohexyl]but-3-en-2-yl] acetate.
| Compound Name | [(E,2S)-4-[(1S,3S,6S)-6-hydroxy-2,2,3,6-tetramethylcyclohexyl]but-3-en-2-yl] acetate |
|---|---|
| PubChem CID | 11242635 |
| Molecular Formula | C16H28O3 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.20 |
| IUPAC Name | [(E,2S)-4-[(1S,3S,6S)-6-hydroxy-2,2,3,6-tetramethylcyclohexyl]but-3-en-2-yl] acetate |
| SMILES | CC(=O)O[C@@H](C)/C=C/[C@H]1C(C)(C)[C@@H](C)CC[C@]1(C)O |
| InChI | InChI=1S/C16H28O3/c1-11-9-10-16(6,18)14(15(11,4)5)8-7-12(2)19-13(3)17/h7-8,11-12,14,18H,9-10H2,1-6H3/b8-7+/t11-,12-,14-,16-/m0/s1 |
| InChIKey | LAHVBPCGLAYTFL-FMZMGORGSA-N |
| XLogP | 3.32 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|