C17H28O5 — CID 177469817
[(1S,4S,5R)-4-[(3R)-3-acetyloxybut-1-enyl]-4-hydroxy-3,3,5-trimethylcyclohexyl] acetate (PubChem CID 177469817) has the molecular formula C17H28O5 and a molecular weight of 312.41 g/mol. Its IUPAC name is [(1S,4S,5R)-4-[(3R)-3-acetyloxybut-1-enyl]-4-hydroxy-3,3,5-trimethylcyclohexyl] acetate.
| Compound Name | [(1S,4S,5R)-4-[(3R)-3-acetyloxybut-1-enyl]-4-hydroxy-3,3,5-trimethylcyclohexyl] acetate |
|---|---|
| PubChem CID | 177469817 |
| Molecular Formula | C17H28O5 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.19 |
| IUPAC Name | [(1S,4S,5R)-4-[(3R)-3-acetyloxybut-1-enyl]-4-hydroxy-3,3,5-trimethylcyclohexyl] acetate |
| SMILES | CC(=O)O[C@H]1C[C@@H](C)[C@](O)(C=C[C@@H](C)OC(C)=O)C(C)(C)C1 |
| InChI | InChI=1S/C17H28O5/c1-11-9-15(22-14(4)19)10-16(5,6)17(11,20)8-7-12(2)21-13(3)18/h7-8,11-12,15,20H,9-10H2,1-6H3/t11-,12-,15+,17-/m1/s1 |
| InChIKey | MHDMVNSFLCBTBQ-BKBUGSPTSA-N |
| XLogP | 2.61 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|