C15H24O2 — CID 20829162
[(E)-4-(2,3-dimethyl-2-bicyclo[2.2.1]heptanyl)but-3-en-2-yl] acetate (PubChem CID 20829162) has the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. Its IUPAC name is [(E)-4-(2,3-dimethyl-2-bicyclo[2.2.1]heptanyl)but-3-en-2-yl] acetate.
| Compound Name | [(E)-4-(2,3-dimethyl-2-bicyclo[2.2.1]heptanyl)but-3-en-2-yl] acetate |
|---|---|
| PubChem CID | 20829162 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | [(E)-4-(2,3-dimethyl-2-bicyclo[2.2.1]heptanyl)but-3-en-2-yl] acetate |
| SMILES | CC(=O)OC(C)/C=C/C1(C)C2CCC(C2)C1C |
| InChI | InChI=1S/C15H24O2/c1-10(17-12(3)16)7-8-15(4)11(2)13-5-6-14(15)9-13/h7-8,10-11,13-14H,5-6,9H2,1-4H3/b8-7+ |
| InChIKey | FPYAKDQNKGPIDI-BQYQJAHWSA-N |
| XLogP | 3.57 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|