C14H22O4 — CID 14335936
[acetyloxy-(3,3-dimethyl-2-bicyclo[2.2.1]heptanyl)methyl] acetate (PubChem CID 14335936) has the molecular formula C14H22O4 and a molecular weight of 254.33 g/mol. Its IUPAC name is [acetyloxy-(3,3-dimethyl-2-bicyclo[2.2.1]heptanyl)methyl] acetate.
| Compound Name | [acetyloxy-(3,3-dimethyl-2-bicyclo[2.2.1]heptanyl)methyl] acetate |
|---|---|
| PubChem CID | 14335936 |
| Molecular Formula | C14H22O4 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | [acetyloxy-(3,3-dimethyl-2-bicyclo[2.2.1]heptanyl)methyl] acetate |
| SMILES | CC(=O)OC(OC(C)=O)C1C2CCC(C2)C1(C)C |
| InChI | InChI=1S/C14H22O4/c1-8(15)17-13(18-9(2)16)12-10-5-6-11(7-10)14(12,3)4/h10-13H,5-7H2,1-4H3 |
| InChIKey | UQVOFBLZRHTPGN-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|