C12H19NO2 — CID 177444300
(2E)-1-[(1S,2R,4R)-3,3-dimethyl-2-bicyclo[2.2.1]heptanyl]-2-hydroxyiminopropan-1-one (PubChem CID 177444300) has the molecular formula C12H19NO2 and a molecular weight of 209.29 g/mol. Its IUPAC name is (2E)-1-[(1S,2R,4R)-3,3-dimethyl-2-bicyclo[2.2.1]heptanyl]-2-hydroxyiminopropan-1-one.
| Compound Name | (2E)-1-[(1S,2R,4R)-3,3-dimethyl-2-bicyclo[2.2.1]heptanyl]-2-hydroxyiminopropan-1-one |
|---|---|
| PubChem CID | 177444300 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | (2E)-1-[(1S,2R,4R)-3,3-dimethyl-2-bicyclo[2.2.1]heptanyl]-2-hydroxyiminopropan-1-one |
| SMILES | C/C(=N\O)C(=O)[C@@H]1[C@H]2CC[C@H](C2)C1(C)C |
| InChI | InChI=1S/C12H19NO2/c1-7(13-15)11(14)10-8-4-5-9(6-8)12(10,2)3/h8-10,15H,4-6H2,1-3H3/b13-7+/t8-,9+,10-/m0/s1 |
| InChIKey | JYTLRDCFKYASEK-BHYZRTMFSA-N |
| XLogP | 2.48 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|