C16H14O4 — CID 11242675
(3aS,5aR)-3a-phenyl-3,4,5a,6-tetrahydro-2H-furo[3,4-g][1]benzofuran-5,8-dione (PubChem CID 11242675) has the molecular formula C16H14O4 and a molecular weight of 270.28 g/mol. Its IUPAC name is (3aS,5aR)-3a-phenyl-3,4,5a,6-tetrahydro-2H-furo[3,4-g][1]benzofuran-5,8-dione.
| Compound Name | (3aS,5aR)-3a-phenyl-3,4,5a,6-tetrahydro-2H-furo[3,4-g][1]benzofuran-5,8-dione |
|---|---|
| PubChem CID | 11242675 |
| Molecular Formula | C16H14O4 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | (3aS,5aR)-3a-phenyl-3,4,5a,6-tetrahydro-2H-furo[3,4-g][1]benzofuran-5,8-dione |
| SMILES | O=C1OC[C@@H]2C(=O)C[C@]3(c4ccccc4)CCOC3=C12 |
| InChI | InChI=1S/C16H14O4/c17-12-8-16(10-4-2-1-3-5-10)6-7-19-14(16)13-11(12)9-20-15(13)18/h1-5,11H,6-9H2/t11-,16+/m1/s1 |
| InChIKey | QOMJAXUKLKCNSL-BZNIZROVSA-N |
| XLogP | 1.74 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |