C14H26O5 — CID 11242799
(4S)-4-[(2R)-2-(2-methoxyethoxymethoxy)pent-4-enyl]-2,2-dimethyl-1,3-dioxolane (PubChem CID 11242799) has the molecular formula C14H26O5 and a molecular weight of 274.36 g/mol. Its IUPAC name is (4S)-4-[(2R)-2-(2-methoxyethoxymethoxy)pent-4-enyl]-2,2-dimethyl-1,3-dioxolane.
| Compound Name | (4S)-4-[(2R)-2-(2-methoxyethoxymethoxy)pent-4-enyl]-2,2-dimethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 11242799 |
| Molecular Formula | C14H26O5 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | (4S)-4-[(2R)-2-(2-methoxyethoxymethoxy)pent-4-enyl]-2,2-dimethyl-1,3-dioxolane |
| SMILES | C=CC[C@H](C[C@H]1COC(C)(C)O1)OCOCCOC |
| InChI | InChI=1S/C14H26O5/c1-5-6-12(17-11-16-8-7-15-4)9-13-10-18-14(2,3)19-13/h5,12-13H,1,6-11H2,2-4H3/t12-,13+/m1/s1 |
| InChIKey | DYSJEJFJBGMPDI-OLZOCXBDSA-N |
| XLogP | 2.11 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|