C15H16F3NO2 — CID 11243495
1-benzyl-5-methyl-2,3-dihydropyridin-1-ium;2,2,2-trifluoroacetate (PubChem CID 11243495) has the molecular formula C15H16F3NO2 and a molecular weight of 299.29 g/mol. Its IUPAC name is 1-benzyl-5-methyl-2,3-dihydropyridin-1-ium;2,2,2-trifluoroacetate.
| Compound Name | 1-benzyl-5-methyl-2,3-dihydropyridin-1-ium;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 11243495 |
| Molecular Formula | C15H16F3NO2 |
| Molecular Weight | 299.29 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | 1-benzyl-5-methyl-2,3-dihydropyridin-1-ium;2,2,2-trifluoroacetate |
| SMILES | CC1=CCC[N+](Cc2ccccc2)=C1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C13H16N.C2HF3O2/c1-12-6-5-9-14(10-12)11-13-7-3-2-4-8-13;3-2(4,5)1(6)7/h2-4,6-8,10H,5,9,11H2,1H3;(H,6,7)/q+1;/p-1 |
| InChIKey | FOVVTUYIADCHBB-UHFFFAOYSA-M |
| XLogP | 1.92 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.29 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|