C19H17F2NO2 — CID 11244366
1-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-2,2-bis(4-fluorophenyl)ethanone (PubChem CID 11244366) has the molecular formula C19H17F2NO2 and a molecular weight of 329.35 g/mol. Its IUPAC name is 1-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-2,2-bis(4-fluorophenyl)ethanone.
| Compound Name | 1-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-2,2-bis(4-fluorophenyl)ethanone |
|---|---|
| PubChem CID | 11244366 |
| Molecular Formula | C19H17F2NO2 |
| Molecular Weight | 329.35 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | 1-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-2,2-bis(4-fluorophenyl)ethanone |
| SMILES | CC1(C)COC(C(=O)C(c2ccc(F)cc2)c2ccc(F)cc2)=N1 |
| InChI | InChI=1S/C19H17F2NO2/c1-19(2)11-24-18(22-19)17(23)16(12-3-7-14(20)8-4-12)13-5-9-15(21)10-6-13/h3-10,16H,11H2,1-2H3 |
| InChIKey | SINPRRBURREXIL-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.35 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |