C14H22O6S2 — CID 11245044
2-S,3-S-diethyl (5R,6R)-5,6-dimethoxy-5,6-dimethyl-1,4-dioxine-2,3-dicarbothioate (PubChem CID 11245044) has the molecular formula C14H22O6S2 and a molecular weight of 350.46 g/mol. Its IUPAC name is 2-S,3-S-diethyl (5R,6R)-5,6-dimethoxy-5,6-dimethyl-1,4-dioxine-2,3-dicarbothioate.
| Compound Name | 2-S,3-S-diethyl (5R,6R)-5,6-dimethoxy-5,6-dimethyl-1,4-dioxine-2,3-dicarbothioate |
|---|---|
| PubChem CID | 11245044 |
| Molecular Formula | C14H22O6S2 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | 2-S,3-S-diethyl (5R,6R)-5,6-dimethoxy-5,6-dimethyl-1,4-dioxine-2,3-dicarbothioate |
| SMILES | CCSC(=O)C1=C(C(=O)SCC)O[C@@](C)(OC)[C@](C)(OC)O1 |
| InChI | InChI=1S/C14H22O6S2/c1-7-21-11(15)9-10(12(16)22-8-2)20-14(4,18-6)13(3,17-5)19-9/h7-8H2,1-6H3/t13-,14-/m1/s1 |
| InChIKey | LHWTWZCXSCBNQX-ZIAGYGMSSA-N |
| XLogP | 2.53 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|