C19H23ClO7S — CID 11189632
S-ethyl (2R,3R,4aR,5R,7aR)-5-(4-chlorophenyl)-2,3-dimethoxy-2,3-dimethyl-7-oxo-5,7a-dihydrofuro[3,4-b][1,4]dioxine-4a-carbothioate (PubChem CID 11189632) has the molecular formula C19H23ClO7S and a molecular weight of 430.91 g/mol. Its IUPAC name is S-ethyl (2R,3R,4aR,5R,7aR)-5-(4-chlorophenyl)-2,3-dimethoxy-2,3-dimethyl-7-oxo-5,7a-dihydrofuro[3,4-b][1,4]dioxine-4a-carbothioate.
| Compound Name | S-ethyl (2R,3R,4aR,5R,7aR)-5-(4-chlorophenyl)-2,3-dimethoxy-2,3-dimethyl-7-oxo-5,7a-dihydrofuro[3,4-b][1,4]dioxine-4a-carbothioate |
|---|---|
| PubChem CID | 11189632 |
| Molecular Formula | C19H23ClO7S |
| Molecular Weight | 430.91 g/mol |
| Exact Mass | 430.09 |
| IUPAC Name | S-ethyl (2R,3R,4aR,5R,7aR)-5-(4-chlorophenyl)-2,3-dimethoxy-2,3-dimethyl-7-oxo-5,7a-dihydrofuro[3,4-b][1,4]dioxine-4a-carbothioate |
| SMILES | CCSC(=O)[C@]12O[C@@](C)(OC)[C@](C)(OC)O[C@H]1C(=O)O[C@@H]2c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H23ClO7S/c1-6-28-16(22)19-13(11-7-9-12(20)10-8-11)25-15(21)14(19)26-17(2,23-4)18(3,24-5)27-19/h7-10,13-14H,6H2,1-5H3/t13-,14+,17-,18-,19-/m1/s1 |
| InChIKey | DUUBCNOQMSKYCM-WKBVASEUSA-N |
| XLogP | 3.10 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.91 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|