C18H33BO4Si — CID 11245095
2-trimethylsilylethyl (2E,4E)-2,4-dimethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)penta-2,4-dienoate (PubChem CID 11245095) has the molecular formula C18H33BO4Si and a molecular weight of 352.36 g/mol. Its IUPAC name is 2-trimethylsilylethyl (2E,4E)-2,4-dimethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)penta-2,4-dienoate.
| Compound Name | 2-trimethylsilylethyl (2E,4E)-2,4-dimethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)penta-2,4-dienoate |
|---|---|
| PubChem CID | 11245095 |
| Molecular Formula | C18H33BO4Si |
| Molecular Weight | 352.36 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | 2-trimethylsilylethyl (2E,4E)-2,4-dimethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)penta-2,4-dienoate |
| SMILES | CC(=C\B1OC(C)(C)C(C)(C)O1)/C=C(\C)C(=O)OCC[Si](C)(C)C |
| InChI | InChI=1S/C18H33BO4Si/c1-14(13-19-22-17(3,4)18(5,6)23-19)12-15(2)16(20)21-10-11-24(7,8)9/h12-13H,10-11H2,1-9H3/b14-13+,15-12+ |
| InChIKey | FADHMNHZHPDRIP-RCQWFYMDSA-N |
| XLogP | 4.39 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.36 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|