C20H32O5 — CID 11245112
(1S,2R,5S,6S,7R)-5,6-bis(1-ethoxyethoxymethyl)tricyclo[5.2.1.02,6]dec-8-en-3-one (PubChem CID 11245112) has the molecular formula C20H32O5 and a molecular weight of 352.47 g/mol. Its IUPAC name is (1S,2R,5S,6S,7R)-5,6-bis(1-ethoxyethoxymethyl)tricyclo[5.2.1.02,6]dec-8-en-3-one.
| Compound Name | (1S,2R,5S,6S,7R)-5,6-bis(1-ethoxyethoxymethyl)tricyclo[5.2.1.02,6]dec-8-en-3-one |
|---|---|
| PubChem CID | 11245112 |
| Molecular Formula | C20H32O5 |
| Molecular Weight | 352.47 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | (1S,2R,5S,6S,7R)-5,6-bis(1-ethoxyethoxymethyl)tricyclo[5.2.1.02,6]dec-8-en-3-one |
| SMILES | CCOC(C)OC[C@H]1CC(=O)[C@@H]2[C@@H]3C=C[C@@H](C3)[C@]12COC(C)OCC |
| InChI | InChI=1S/C20H32O5/c1-5-22-13(3)24-11-17-10-18(21)19-15-7-8-16(9-15)20(17,19)12-25-14(4)23-6-2/h7-8,13-17,19H,5-6,9-12H2,1-4H3/t13?,14?,15-,16+,17-,19+,20-/m1/s1 |
| InChIKey | UVKIDJUGBTZVMZ-QBDDWJOXSA-N |
| XLogP | 3.18 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.47 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|