C25H38O5 — CID 11247107
(1S,2R,5R,6S,7R)-5-(methoxymethoxymethyl)-5-[[(1R,2R,5R)-2-[3-(methoxymethoxy)prop-1-en-2-yl]-5-methylcyclopentyl]methyl]tricyclo[5.2.1.02,6]dec-8-en-3-one (PubChem CID 11247107) has the molecular formula C25H38O5 and a molecular weight of 418.57 g/mol. Its IUPAC name is (1S,2R,5R,6S,7R)-5-(methoxymethoxymethyl)-5-[[(1R,2R,5R)-2-[3-(methoxymethoxy)prop-1-en-2-yl]-5-methylcyclopentyl]methyl]tricyclo[5.2.1.02,6]dec-8-en-3-one.
| Compound Name | (1S,2R,5R,6S,7R)-5-(methoxymethoxymethyl)-5-[[(1R,2R,5R)-2-[3-(methoxymethoxy)prop-1-en-2-yl]-5-methylcyclopentyl]methyl]tricyclo[5.2.1.02,6]dec-8-en-3-one |
|---|---|
| PubChem CID | 11247107 |
| Molecular Formula | C25H38O5 |
| Molecular Weight | 418.57 g/mol |
| Exact Mass | 418.27 |
| IUPAC Name | (1S,2R,5R,6S,7R)-5-(methoxymethoxymethyl)-5-[[(1R,2R,5R)-2-[3-(methoxymethoxy)prop-1-en-2-yl]-5-methylcyclopentyl]methyl]tricyclo[5.2.1.02,6]dec-8-en-3-one |
| SMILES | C=C(COCOC)[C@@H]1CC[C@@H](C)[C@H]1C[C@@]1(COCOC)CC(=O)[C@H]2[C@@H]1[C@H]1C=C[C@@H]2C1 |
| InChI | InChI=1S/C25H38O5/c1-16-5-8-20(17(2)12-29-14-27-3)21(16)10-25(13-30-15-28-4)11-22(26)23-18-6-7-19(9-18)24(23)25/h6-7,16,18-21,23-24H,2,5,8-15H2,1,3-4H3/t16-,18-,19+,20+,21-,23+,24+,25+/m1/s1 |
| InChIKey | LRYVPPXUSNGVKY-URAMJOFRSA-N |
| XLogP | 4.23 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.57 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|