C30H46O6 — CID 101241271
methyl (1S,2R,5S,6S,7R)-5-(methoxymethoxymethyl)-5-[[(1R,2R,5R)-2-[3-(methoxymethoxy)prop-1-en-2-yl]-5-methylcyclopentyl]methyl]-3-propan-2-yltricyclo[5.2.1.02,6]deca-3,8-diene-4-carboxylate (PubChem CID 101241271) has the molecular formula C30H46O6 and a molecular weight of 502.69 g/mol. Its IUPAC name is methyl (1S,2R,5S,6S,7R)-5-(methoxymethoxymethyl)-5-[[(1R,2R,5R)-2-[3-(methoxymethoxy)prop-1-en-2-yl]-5-methylcyclopentyl]methyl]-3-propan-2-yltricyclo[5.2.1.02,6]deca-3,8-diene-4-carboxylate.
| Compound Name | methyl (1S,2R,5S,6S,7R)-5-(methoxymethoxymethyl)-5-[[(1R,2R,5R)-2-[3-(methoxymethoxy)prop-1-en-2-yl]-5-methylcyclopentyl]methyl]-3-propan-2-yltricyclo[5.2.1.02,6]deca-3,8-diene-4-carboxylate |
|---|---|
| PubChem CID | 101241271 |
| Molecular Formula | C30H46O6 |
| Molecular Weight | 502.69 g/mol |
| Exact Mass | 502.33 |
| IUPAC Name | methyl (1S,2R,5S,6S,7R)-5-(methoxymethoxymethyl)-5-[[(1R,2R,5R)-2-[3-(methoxymethoxy)prop-1-en-2-yl]-5-methylcyclopentyl]methyl]-3-propan-2-yltricyclo[5.2.1.02,6]deca-3,8-diene-4-carboxylate |
| SMILES | C=C(COCOC)[C@@H]1CC[C@@H](C)[C@H]1C[C@@]1(COCOC)C(C(=O)OC)=C(C(C)C)[C@H]2[C@@H]1[C@H]1C=C[C@@H]2C1 |
| InChI | InChI=1S/C30H46O6/c1-18(2)25-26-21-9-10-22(12-21)27(26)30(15-36-17-33-6,28(25)29(31)34-7)13-24-19(3)8-11-23(24)20(4)14-35-16-32-5/h9-10,18-19,21-24,26-27H,4,8,11-17H2,1-3,5-7H3/t19-,21-,22+,23+,24-,26+,27+,30+/m1/s1 |
| InChIKey | UFSGFKCIWWKPKK-OAGBBNRMSA-N |
| XLogP | 5.40 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.69 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|