C20H28O3 — CID 134922786
methyl (1S,2R,5S,6S,7R)-5-formyl-5-(2-methylpropyl)-3-propyltricyclo[5.2.1.02,6]deca-3,8-diene-4-carboxylate (PubChem CID 134922786) has the molecular formula C20H28O3 and a molecular weight of 316.44 g/mol. Its IUPAC name is methyl (1S,2R,5S,6S,7R)-5-formyl-5-(2-methylpropyl)-3-propyltricyclo[5.2.1.02,6]deca-3,8-diene-4-carboxylate.
| Compound Name | methyl (1S,2R,5S,6S,7R)-5-formyl-5-(2-methylpropyl)-3-propyltricyclo[5.2.1.02,6]deca-3,8-diene-4-carboxylate |
|---|---|
| PubChem CID | 134922786 |
| Molecular Formula | C20H28O3 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | methyl (1S,2R,5S,6S,7R)-5-formyl-5-(2-methylpropyl)-3-propyltricyclo[5.2.1.02,6]deca-3,8-diene-4-carboxylate |
| SMILES | CCCC1=C(C(=O)OC)[C@](C=O)(CC(C)C)[C@@H]2[C@H]1[C@@H]1C=C[C@H]2C1 |
| InChI | InChI=1S/C20H28O3/c1-5-6-15-16-13-7-8-14(9-13)17(16)20(11-21,10-12(2)3)18(15)19(22)23-4/h7-8,11-14,16-17H,5-6,9-10H2,1-4H3/t13-,14+,16+,17+,20+/m1/s1 |
| InChIKey | BCTAGCJCZPEWJO-FVALFLQTSA-N |
| XLogP | 3.94 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|