C14H16O4 — CID 10911877
dimethyl (1R,2S,6R,7R)-tricyclo[5.2.1.02,6]deca-4,8-diene-1,4-dicarboxylate (PubChem CID 10911877) has the molecular formula C14H16O4 and a molecular weight of 248.28 g/mol. Its IUPAC name is dimethyl (1R,2S,6R,7R)-tricyclo[5.2.1.02,6]deca-4,8-diene-1,4-dicarboxylate.
| Compound Name | dimethyl (1R,2S,6R,7R)-tricyclo[5.2.1.02,6]deca-4,8-diene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 10911877 |
| Molecular Formula | C14H16O4 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | dimethyl (1R,2S,6R,7R)-tricyclo[5.2.1.02,6]deca-4,8-diene-1,4-dicarboxylate |
| SMILES | COC(=O)C1=C[C@H]2[C@H]3C=C[C@](C(=O)OC)(C3)[C@H]2C1 |
| InChI | InChI=1S/C14H16O4/c1-17-12(15)9-5-10-8-3-4-14(7-8,11(10)6-9)13(16)18-2/h3-5,8,10-11H,6-7H2,1-2H3/t8-,10-,11-,14-/m0/s1 |
| InChIKey | DPKXOZQXQAWHFU-AEHQLWAISA-N |
| XLogP | 1.47 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|