C15H18O4 — CID 10015560
ethyl (1'R,2'R,6'R,7'S)-spiro[1,3-dioxolane-2,5'-tricyclo[5.2.1.02,6]deca-3,8-diene]-2'-carboxylate (PubChem CID 10015560) has the molecular formula C15H18O4 and a molecular weight of 262.30 g/mol. Its IUPAC name is ethyl (1'R,2'R,6'R,7'S)-spiro[1,3-dioxolane-2,5'-tricyclo[5.2.1.02,6]deca-3,8-diene]-2'-carboxylate.
| Compound Name | ethyl (1'R,2'R,6'R,7'S)-spiro[1,3-dioxolane-2,5'-tricyclo[5.2.1.02,6]deca-3,8-diene]-2'-carboxylate |
|---|---|
| PubChem CID | 10015560 |
| Molecular Formula | C15H18O4 |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | ethyl (1'R,2'R,6'R,7'S)-spiro[1,3-dioxolane-2,5'-tricyclo[5.2.1.02,6]deca-3,8-diene]-2'-carboxylate |
| SMILES | CCOC(=O)[C@@]12C=CC3(OCCO3)[C@@H]1[C@@H]1C=C[C@H]2C1 |
| InChI | InChI=1S/C15H18O4/c1-2-17-13(16)14-5-6-15(18-7-8-19-15)12(14)10-3-4-11(14)9-10/h3-6,10-12H,2,7-9H2,1H3/t10-,11+,12-,14-/m1/s1 |
| InChIKey | GIFLTCZINBLJRP-GFQSEFKGSA-N |
| XLogP | 1.67 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.30 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|