C17H34O4Si2 — CID 11245306
(3aR,6R,7aS)-6-[tert-butyl(dimethyl)silyl]oxy-3a-trimethylsilyloxy-3,4,5,6,7,7a-hexahydro-1-benzofuran-2-one (PubChem CID 11245306) has the molecular formula C17H34O4Si2 and a molecular weight of 358.63 g/mol. Its IUPAC name is (3aR,6R,7aS)-6-[tert-butyl(dimethyl)silyl]oxy-3a-trimethylsilyloxy-3,4,5,6,7,7a-hexahydro-1-benzofuran-2-one.
| Compound Name | (3aR,6R,7aS)-6-[tert-butyl(dimethyl)silyl]oxy-3a-trimethylsilyloxy-3,4,5,6,7,7a-hexahydro-1-benzofuran-2-one |
|---|---|
| PubChem CID | 11245306 |
| Molecular Formula | C17H34O4Si2 |
| Molecular Weight | 358.63 g/mol |
| Exact Mass | 358.20 |
| IUPAC Name | (3aR,6R,7aS)-6-[tert-butyl(dimethyl)silyl]oxy-3a-trimethylsilyloxy-3,4,5,6,7,7a-hexahydro-1-benzofuran-2-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1CC[C@@]2(O[Si](C)(C)C)CC(=O)O[C@H]2C1 |
| InChI | InChI=1S/C17H34O4Si2/c1-16(2,3)23(7,8)20-13-9-10-17(21-22(4,5)6)12-15(18)19-14(17)11-13/h13-14H,9-12H2,1-8H3/t13-,14+,17-/m1/s1 |
| InChIKey | KYKZEIOZOIBFKS-JKIFEVAISA-N |
| XLogP | 4.47 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.63 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|