C19H36O7Si — CID 11177181
methyl (3aS,4R,5S,7S,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-4,5-dimethoxy-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-1,3-benzodioxole-5-carboxylate (PubChem CID 11177181) has the molecular formula C19H36O7Si and a molecular weight of 404.58 g/mol. Its IUPAC name is methyl (3aS,4R,5S,7S,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-4,5-dimethoxy-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-1,3-benzodioxole-5-carboxylate.
| Compound Name | methyl (3aS,4R,5S,7S,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-4,5-dimethoxy-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 11177181 |
| Molecular Formula | C19H36O7Si |
| Molecular Weight | 404.58 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | methyl (3aS,4R,5S,7S,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-4,5-dimethoxy-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-1,3-benzodioxole-5-carboxylate |
| SMILES | COC(=O)[C@]1(OC)C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]2OC(C)(C)O[C@@H]2[C@H]1OC |
| InChI | InChI=1S/C19H36O7Si/c1-17(2,3)27(9,10)26-12-11-19(23-8,16(20)22-7)15(21-6)14-13(12)24-18(4,5)25-14/h12-15H,11H2,1-10H3/t12-,13-,14-,15+,19-/m0/s1 |
| InChIKey | CEUFXBWNIPYOAC-CYBJUQQLSA-N |
| XLogP | 2.87 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.58 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|