C24H34O3 — CID 11245679
(3S,10R,13S,16R,17R)-3-(cyclopenten-1-yl)-16,17-dihydroxy-10,13-dimethyl-1,2,3,4,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-7-one (PubChem CID 11245679) has the molecular formula C24H34O3 and a molecular weight of 370.53 g/mol. Its IUPAC name is (3S,10R,13S,16R,17R)-3-(cyclopenten-1-yl)-16,17-dihydroxy-10,13-dimethyl-1,2,3,4,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-7-one.
| Compound Name | (3S,10R,13S,16R,17R)-3-(cyclopenten-1-yl)-16,17-dihydroxy-10,13-dimethyl-1,2,3,4,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-7-one |
|---|---|
| PubChem CID | 11245679 |
| Molecular Formula | C24H34O3 |
| Molecular Weight | 370.53 g/mol |
| Exact Mass | 370.25 |
| IUPAC Name | (3S,10R,13S,16R,17R)-3-(cyclopenten-1-yl)-16,17-dihydroxy-10,13-dimethyl-1,2,3,4,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-7-one |
| SMILES | C[C@]12CC[C@H](C3=CCCC3)CC1=CC(=O)C1C2CC[C@@]2(C)C1C[C@@H](O)[C@@H]2O |
| InChI | InChI=1S/C24H34O3/c1-23-9-7-15(14-5-3-4-6-14)11-16(23)12-19(25)21-17(23)8-10-24(2)18(21)13-20(26)22(24)27/h5,12,15,17-18,20-22,26-27H,3-4,6-11,13H2,1-2H3/t15-,17?,18?,20+,21?,22-,23-,24-/m0/s1 |
| InChIKey | WYHIFLROHPCRPJ-LJVNNNHXSA-N |
| XLogP | 4.19 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.53 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|