C20H24N2O5 — CID 11245726
benzyl (3R,4S)-4-cyano-1-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-2-oxopiperidine-3-carboxylate (PubChem CID 11245726) has the molecular formula C20H24N2O5 and a molecular weight of 372.42 g/mol. Its IUPAC name is benzyl (3R,4S)-4-cyano-1-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-2-oxopiperidine-3-carboxylate.
| Compound Name | benzyl (3R,4S)-4-cyano-1-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-2-oxopiperidine-3-carboxylate |
|---|---|
| PubChem CID | 11245726 |
| Molecular Formula | C20H24N2O5 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | benzyl (3R,4S)-4-cyano-1-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-2-oxopiperidine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)CN1CC[C@H](C#N)[C@@H](C(=O)OCc2ccccc2)C1=O |
| InChI | InChI=1S/C20H24N2O5/c1-20(2,3)27-16(23)12-22-10-9-15(11-21)17(18(22)24)19(25)26-13-14-7-5-4-6-8-14/h4-8,15,17H,9-10,12-13H2,1-3H3/t15-,17-/m1/s1 |
| InChIKey | GFFLMMIPYCFMPZ-NVXWUHKLSA-N |
| XLogP | 2.06 |
| TPSA | 96.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|