C25H31NOSi — CID 11246261
2-[tert-butyl(diphenyl)silyl]-1-(2,4,5-trimethyl-1H-pyrrol-3-yl)ethanone (PubChem CID 11246261) has the molecular formula C25H31NOSi and a molecular weight of 389.62 g/mol. Its IUPAC name is 2-[tert-butyl(diphenyl)silyl]-1-(2,4,5-trimethyl-1H-pyrrol-3-yl)ethanone.
| Compound Name | 2-[tert-butyl(diphenyl)silyl]-1-(2,4,5-trimethyl-1H-pyrrol-3-yl)ethanone |
|---|---|
| PubChem CID | 11246261 |
| Molecular Formula | C25H31NOSi |
| Molecular Weight | 389.62 g/mol |
| Exact Mass | 389.22 |
| IUPAC Name | 2-[tert-butyl(diphenyl)silyl]-1-(2,4,5-trimethyl-1H-pyrrol-3-yl)ethanone |
| SMILES | Cc1[nH]c(C)c(C(=O)C[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)c1C |
| InChI | InChI=1S/C25H31NOSi/c1-18-19(2)26-20(3)24(18)23(27)17-28(25(4,5)6,21-13-9-7-10-14-21)22-15-11-8-12-16-22/h7-16,26H,17H2,1-6H3 |
| InChIKey | AJOHBDFDOQHWQM-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.62 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|