C25H34OSi — CID 101034326
1-[2-[[tert-butyl(diphenyl)silyl]methyl]prop-2-enyl]cyclopentan-1-ol (PubChem CID 101034326) has the molecular formula C25H34OSi and a molecular weight of 378.63 g/mol. Its IUPAC name is 1-[2-[[tert-butyl(diphenyl)silyl]methyl]prop-2-enyl]cyclopentan-1-ol.
| Compound Name | 1-[2-[[tert-butyl(diphenyl)silyl]methyl]prop-2-enyl]cyclopentan-1-ol |
|---|---|
| PubChem CID | 101034326 |
| Molecular Formula | C25H34OSi |
| Molecular Weight | 378.63 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | 1-[2-[[tert-butyl(diphenyl)silyl]methyl]prop-2-enyl]cyclopentan-1-ol |
| SMILES | C=C(CC1(O)CCCC1)C[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C25H34OSi/c1-21(19-25(26)17-11-12-18-25)20-27(24(2,3)4,22-13-7-5-8-14-22)23-15-9-6-10-16-23/h5-10,13-16,26H,1,11-12,17-20H2,2-4H3 |
| InChIKey | WCUUAXUUZFMBFS-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.63 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|