C31H42OSi — CID 11167043
[(3S,8aR)-spiro[3,4,6,7,8,8a-hexahydroisochromene-1,1'-cyclohexane]-3-yl]methyl-tert-butyl-diphenylsilane (PubChem CID 11167043) has the molecular formula C31H42OSi and a molecular weight of 458.76 g/mol. Its IUPAC name is [(3S,8aR)-spiro[3,4,6,7,8,8a-hexahydroisochromene-1,1'-cyclohexane]-3-yl]methyl-tert-butyl-diphenylsilane.
| Compound Name | [(3S,8aR)-spiro[3,4,6,7,8,8a-hexahydroisochromene-1,1'-cyclohexane]-3-yl]methyl-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 11167043 |
| Molecular Formula | C31H42OSi |
| Molecular Weight | 458.76 g/mol |
| Exact Mass | 458.30 |
| IUPAC Name | [(3S,8aR)-spiro[3,4,6,7,8,8a-hexahydroisochromene-1,1'-cyclohexane]-3-yl]methyl-tert-butyl-diphenylsilane |
| SMILES | CC(C)(C)[Si](C[C@@H]1CC2=CCCC[C@H]2C2(CCCCC2)O1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H42OSi/c1-30(2,3)33(27-16-7-4-8-17-27,28-18-9-5-10-19-28)24-26-23-25-15-11-12-20-29(25)31(32-26)21-13-6-14-22-31/h4-5,7-10,15-19,26,29H,6,11-14,20-24H2,1-3H3/t26-,29+/m0/s1 |
| InChIKey | ATSMMPWRFDCCDT-LITSAYRRSA-N |
| XLogP | 7.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.76 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|