C33H38OSi — CID 11751954
(2R,5S)-2-[[tert-butyl(diphenyl)silyl]methyl]-4-phenylspiro[4.5]dec-3-en-10-one (PubChem CID 11751954) has the molecular formula C33H38OSi and a molecular weight of 478.75 g/mol. Its IUPAC name is (2R,5S)-2-[[tert-butyl(diphenyl)silyl]methyl]-4-phenylspiro[4.5]dec-3-en-10-one.
| Compound Name | (2R,5S)-2-[[tert-butyl(diphenyl)silyl]methyl]-4-phenylspiro[4.5]dec-3-en-10-one |
|---|---|
| PubChem CID | 11751954 |
| Molecular Formula | C33H38OSi |
| Molecular Weight | 478.75 g/mol |
| Exact Mass | 478.27 |
| IUPAC Name | (2R,5S)-2-[[tert-butyl(diphenyl)silyl]methyl]-4-phenylspiro[4.5]dec-3-en-10-one |
| SMILES | CC(C)(C)[Si](C[C@H]1C=C(c2ccccc2)[C@]2(CCCCC2=O)C1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H38OSi/c1-32(2,3)35(28-17-9-5-10-18-28,29-19-11-6-12-20-29)25-26-23-30(27-15-7-4-8-16-27)33(24-26)22-14-13-21-31(33)34/h4-12,15-20,23,26H,13-14,21-22,24-25H2,1-3H3/t26-,33-/m0/s1 |
| InChIKey | MOESWNOBSIDCRB-UBOZLPQGSA-N |
| XLogP | 7.28 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.75 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|