C19H30OSi — CID 100920672
1-[(2R)-2-[dimethyl(phenyl)silyl]-3-methylbut-3-enyl]cyclohexan-1-ol (PubChem CID 100920672) has the molecular formula C19H30OSi and a molecular weight of 302.53 g/mol. Its IUPAC name is 1-[(2R)-2-[dimethyl(phenyl)silyl]-3-methylbut-3-enyl]cyclohexan-1-ol.
| Compound Name | 1-[(2R)-2-[dimethyl(phenyl)silyl]-3-methylbut-3-enyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 100920672 |
| Molecular Formula | C19H30OSi |
| Molecular Weight | 302.53 g/mol |
| Exact Mass | 302.21 |
| IUPAC Name | 1-[(2R)-2-[dimethyl(phenyl)silyl]-3-methylbut-3-enyl]cyclohexan-1-ol |
| SMILES | C=C(C)[C@@H](CC1(O)CCCCC1)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C19H30OSi/c1-16(2)18(15-19(20)13-9-6-10-14-19)21(3,4)17-11-7-5-8-12-17/h5,7-8,11-12,18,20H,1,6,9-10,13-15H2,2-4H3/t18-/m1/s1 |
| InChIKey | FPHKNIMCWXECRN-GOSISDBHSA-N |
| XLogP | 4.63 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.53 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|