C24H22FNO3 — CID 11246302
1'-butanoyl-5-[2-(3-fluorophenyl)ethynyl]spiro[1-benzofuran-2,4'-piperidine]-3-one (PubChem CID 11246302) has the molecular formula C24H22FNO3 and a molecular weight of 391.44 g/mol. Its IUPAC name is 1'-butanoyl-5-[2-(3-fluorophenyl)ethynyl]spiro[1-benzofuran-2,4'-piperidine]-3-one.
| Compound Name | 1'-butanoyl-5-[2-(3-fluorophenyl)ethynyl]spiro[1-benzofuran-2,4'-piperidine]-3-one |
|---|---|
| PubChem CID | 11246302 |
| Molecular Formula | C24H22FNO3 |
| Molecular Weight | 391.44 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | 1'-butanoyl-5-[2-(3-fluorophenyl)ethynyl]spiro[1-benzofuran-2,4'-piperidine]-3-one |
| SMILES | CCCC(=O)N1CCC2(CC1)Oc1ccc(C#Cc3cccc(F)c3)cc1C2=O |
| InChI | InChI=1S/C24H22FNO3/c1-2-4-22(27)26-13-11-24(12-14-26)23(28)20-16-18(9-10-21(20)29-24)8-7-17-5-3-6-19(25)15-17/h3,5-6,9-10,15-16H,2,4,11-14H2,1H3 |
| InChIKey | VFDFKWGAHRCJQE-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.44 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|