C24H32O4S — CID 11247053
[(1S,2R,4R)-1-(benzenesulfonylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] 5,5-dimethylhexa-2,3-dienoate (PubChem CID 11247053) has the molecular formula C24H32O4S and a molecular weight of 416.58 g/mol. Its IUPAC name is [(1S,2R,4R)-1-(benzenesulfonylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] 5,5-dimethylhexa-2,3-dienoate.
| Compound Name | [(1S,2R,4R)-1-(benzenesulfonylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] 5,5-dimethylhexa-2,3-dienoate |
|---|---|
| PubChem CID | 11247053 |
| Molecular Formula | C24H32O4S |
| Molecular Weight | 416.58 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | [(1S,2R,4R)-1-(benzenesulfonylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] 5,5-dimethylhexa-2,3-dienoate |
| SMILES | CC(C)(C)C=C=CC(=O)O[C@@H]1C[C@H]2CC[C@]1(CS(=O)(=O)c1ccccc1)C2(C)C |
| InChI | InChI=1S/C24H32O4S/c1-22(2,3)14-9-12-21(25)28-20-16-18-13-15-24(20,23(18,4)5)17-29(26,27)19-10-7-6-8-11-19/h6-8,10-12,14,18,20H,13,15-17H2,1-5H3/t9?,18-,20-,24-/m1/s1 |
| InChIKey | NIXUPGSYXIQKNA-XLVXDVDJSA-N |
| XLogP | 4.96 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.58 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|