C20H21ClN6O2 — CID 1124898
8-[2-[4-(2-chlorophenyl)but-3-en-2-ylidene]hydrazinyl]-3-methyl-7-(2-methylprop-2-enyl)purine-2,6-dione (PubChem CID 1124898) has the molecular formula C20H21ClN6O2 and a molecular weight of 412.88 g/mol. Its IUPAC name is 8-[2-[4-(2-chlorophenyl)but-3-en-2-ylidene]hydrazinyl]-3-methyl-7-(2-methylprop-2-enyl)purine-2,6-dione.
| Compound Name | 8-[2-[4-(2-chlorophenyl)but-3-en-2-ylidene]hydrazinyl]-3-methyl-7-(2-methylprop-2-enyl)purine-2,6-dione |
|---|---|
| PubChem CID | 1124898 |
| Molecular Formula | C20H21ClN6O2 |
| Molecular Weight | 412.88 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | 8-[2-[4-(2-chlorophenyl)but-3-en-2-ylidene]hydrazinyl]-3-methyl-7-(2-methylprop-2-enyl)purine-2,6-dione |
| SMILES | C=C(C)Cn1c(NN=C(C)C=Cc2ccccc2Cl)nc2c1c(=O)[nH]c(=O)n2C |
| InChI | InChI=1S/C20H21ClN6O2/c1-12(2)11-27-16-17(26(4)20(29)23-18(16)28)22-19(27)25-24-13(3)9-10-14-7-5-6-8-15(14)21/h5-10H,1,11H2,2-4H3,(H,22,25)(H,23,28,29) |
| InChIKey | NOBMXXMEEWSKDX-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 97.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.88 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|